C23H29FN4O5 — CID 57158760
1-cyclopropyl-6-fluoro-7-[3-[1-[formyl-[(2-methylpropan-2-yl)oxy]amino]ethyl]pyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 57158760) has the molecular formula C23H29FN4O5 and a molecular weight of 460.51 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[3-[1-[formyl-[(2-methylpropan-2-yl)oxy]amino]ethyl]pyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[3-[1-[formyl-[(2-methylpropan-2-yl)oxy]amino]ethyl]pyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 57158760 |
| Molecular Formula | C23H29FN4O5 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[3-[1-[formyl-[(2-methylpropan-2-yl)oxy]amino]ethyl]pyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CC(C1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)C1)N(C=O)OC(C)(C)C |
| InChI | InChI=1S/C23H29FN4O5/c1-13(28(12-29)33-23(2,3)4)14-7-8-26(10-14)21-18(24)9-16-19(30)17(22(31)32)11-27(15-5-6-15)20(16)25-21/h9,11-15H,5-8,10H2,1-4H3,(H,31,32) |
| InChIKey | IUPVZKSKMZVVDA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|