About 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine
6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine (PubChem CID 57159616) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine |
| PubChem CID | 57159616 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine |
| SMILES | CC1=C(C2=CCCC=N2)N=CCC1 |
| InChI | InChI=1S/C11H14N2/c1-9-5-4-8-13-11(9)10-6-2-3-7-12-10/h6-8H,2-5H2,1H3 |
| InChIKey | YLINHSCXVIYYPS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine?
The IUPAC name of 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine (CID 57159616) is 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine.
What is the SMILES notation for 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine?
The canonical SMILES for 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine is CC1=C(C2=CCCC=N2)N=CCC1.
What is the InChIKey of 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine?
The InChIKey is YLINHSCXVIYYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-9-5-4-8-13-11(9)10-6-2-3-7-12-10/h6-8H,2-5H2,1H3.
What are the key properties of 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine?
6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine has a molecular weight of 174.25 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dihydropyridin-6-yl)-5-methyl-3,4-dihydropyridine is sourced from PubChem (CID 57159616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).