C27H42O5 — CID 57159759
methyl 5-[(3aR,5S,6S,6aS)-5-(oxan-2-yloxy)-6-(3-oxooct-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (PubChem CID 57159759) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is methyl 5-[(3aR,5S,6S,6aS)-5-(oxan-2-yloxy)-6-(3-oxooct-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aR,5S,6S,6aS)-5-(oxan-2-yloxy)-6-(3-oxooct-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 57159759 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | methyl 5-[(3aR,5S,6S,6aS)-5-(oxan-2-yloxy)-6-(3-oxooct-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| SMILES | CCCCCC(=O)C=C[C@H]1[C@H]2CC(CCCCC(=O)OC)=C[C@@H]2C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H42O5/c1-3-4-5-11-22(28)14-15-23-24-18-20(10-6-7-12-26(29)30-2)17-21(24)19-25(23)32-27-13-8-9-16-31-27/h14-15,17,21,23-25,27H,3-13,16,18-19H2,1-2H3/t21-,23+,24+,25+,27?/m1/s1 |
| InChIKey | XXWCSSNHVVRFLO-GQWIGJIUSA-N |
| XLogP | 5.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|