C21H31N5O5S2 — CID 57159849
ditert-butyl (3S,6R)-8-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]decane-4,9-dicarboxylate (PubChem CID 57159849) has the molecular formula C21H31N5O5S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is ditert-butyl (3S,6R)-8-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]decane-4,9-dicarboxylate.
| Compound Name | ditert-butyl (3S,6R)-8-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]decane-4,9-dicarboxylate |
|---|---|
| PubChem CID | 57159849 |
| Molecular Formula | C21H31N5O5S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | ditert-butyl (3S,6R)-8-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]decane-4,9-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(CSc2nnc(N)s2)C[C@@H]2CN(C(=O)OC(C)(C)C)[C@@H]3C(=O)N1C23 |
| InChI | InChI=1S/C21H31N5O5S2/c1-20(2,3)30-16(28)13-11(9-32-18-24-23-17(22)33-18)7-10-8-25(19(29)31-21(4,5)6)14-12(10)26(13)15(14)27/h10-14H,7-9H2,1-6H3,(H2,22,23)/t10-,11?,12?,13?,14+/m1/s1 |
| InChIKey | KPXHWZBIDAIYEP-BSZWHHKSSA-N |
| XLogP | 2.39 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |