C16H29NO2 — CID 57160864
3-[2-(dimethylamino)ethyl]-5,9-dimethyldeca-4,8-dienoic acid (PubChem CID 57160864) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-5,9-dimethyldeca-4,8-dienoic acid.
| Compound Name | 3-[2-(dimethylamino)ethyl]-5,9-dimethyldeca-4,8-dienoic acid |
|---|---|
| PubChem CID | 57160864 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-5,9-dimethyldeca-4,8-dienoic acid |
| SMILES | CC(C)=CCCC(C)=CC(CCN(C)C)CC(=O)O |
| InChI | InChI=1S/C16H29NO2/c1-13(2)7-6-8-14(3)11-15(12-16(18)19)9-10-17(4)5/h7,11,15H,6,8-10,12H2,1-5H3,(H,18,19) |
| InChIKey | ZCAXSYKEKUREKM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|