C21H24F7NO4 — CID 57161216
2-(fluoromethyl)-4-[2-fluoro-6-(1,1,2,2,2-pentafluoroethyl)phenyl]-3,6-dimethyl-5-propan-2-ylpiperidine-3,5-dicarboxylic acid (PubChem CID 57161216) has the molecular formula C21H24F7NO4 and a molecular weight of 487.41 g/mol. Its IUPAC name is 2-(fluoromethyl)-4-[2-fluoro-6-(1,1,2,2,2-pentafluoroethyl)phenyl]-3,6-dimethyl-5-propan-2-ylpiperidine-3,5-dicarboxylic acid.
| Compound Name | 2-(fluoromethyl)-4-[2-fluoro-6-(1,1,2,2,2-pentafluoroethyl)phenyl]-3,6-dimethyl-5-propan-2-ylpiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57161216 |
| Molecular Formula | C21H24F7NO4 |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-(fluoromethyl)-4-[2-fluoro-6-(1,1,2,2,2-pentafluoroethyl)phenyl]-3,6-dimethyl-5-propan-2-ylpiperidine-3,5-dicarboxylic acid |
| SMILES | CC(C)C1(C(=O)O)C(C)NC(CF)C(C)(C(=O)O)C1c1c(F)cccc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H24F7NO4/c1-9(2)19(17(32)33)10(3)29-13(8-22)18(4,16(30)31)15(19)14-11(6-5-7-12(14)23)20(24,25)21(26,27)28/h5-7,9-10,13,15,29H,8H2,1-4H3,(H,30,31)(H,32,33) |
| InChIKey | VFCHTJWUDDHUEO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|