C22H28BrFO4 — CID 57161529
[2-[(6S,8S,9R,10S,13S,14S,17S)-6-bromo-9-fluoro-13-methyl-3-oxo-1,2,6,7,8,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 57161529) has the molecular formula C22H28BrFO4 and a molecular weight of 455.36 g/mol. Its IUPAC name is [2-[(6S,8S,9R,10S,13S,14S,17S)-6-bromo-9-fluoro-13-methyl-3-oxo-1,2,6,7,8,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(6S,8S,9R,10S,13S,14S,17S)-6-bromo-9-fluoro-13-methyl-3-oxo-1,2,6,7,8,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 57161529 |
| Molecular Formula | C22H28BrFO4 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [2-[(6S,8S,9R,10S,13S,14S,17S)-6-bromo-9-fluoro-13-methyl-3-oxo-1,2,6,7,8,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3C[C@H](Br)C4=CC(=O)CC[C@@H]4[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C22H28BrFO4/c1-12(25)28-11-20(27)17-6-5-16-18-10-19(23)14-9-13(26)3-4-15(14)22(18,24)8-7-21(16,17)2/h9,15-19H,3-8,10-11H2,1-2H3/t15-,16-,17+,18-,19-,21-,22-/m0/s1 |
| InChIKey | NQCTVYBIFZGAJB-RPRDNOHOSA-N |
| XLogP | 4.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|