About N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide
N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide (PubChem CID 57161917) has the molecular formula C4H10N2OS2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide |
| PubChem CID | 57161917 |
| Molecular Formula | C4H10N2OS2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide |
| SMILES | NCCNC(=O)C(S)S |
| InChI | InChI=1S/C4H10N2OS2/c5-1-2-6-3(7)4(8)9/h4,8-9H,1-2,5H2,(H,6,7) |
| InChIKey | MQFDGLAHEPKSGL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide?
The IUPAC name of N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide (CID 57161917) is N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide.
What is the SMILES notation for N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide?
The canonical SMILES for N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide is NCCNC(=O)C(S)S.
What is the InChIKey of N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide?
The InChIKey is MQFDGLAHEPKSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2OS2/c5-1-2-6-3(7)4(8)9/h4,8-9H,1-2,5H2,(H,6,7).
What are the key properties of N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide?
N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide has a molecular weight of 166.27 g/mol, XLogP of -0.75, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2,2-bis(sulfanyl)acetamide is sourced from PubChem (CID 57161917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).