About [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol
[(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol (PubChem CID 57162301) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol |
| PubChem CID | 57162301 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol |
| SMILES | OC[C@@H]1CC[C@@H](Nc2ncccn2)C1 |
| InChI | InChI=1S/C10H15N3O/c14-7-8-2-3-9(6-8)13-10-11-4-1-5-12-10/h1,4-5,8-9,14H,2-3,6-7H2,(H,11,12,13)/t8-,9-/m1/s1 |
| InChIKey | OGPDXONMPVDODU-RKDXNWHRSA-N |
| XLogP | 1.05 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol?
The IUPAC name of [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol (CID 57162301) is [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol.
What is the SMILES notation for [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol?
The canonical SMILES for [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol is OC[C@@H]1CC[C@@H](Nc2ncccn2)C1.
What is the InChIKey of [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol?
The InChIKey is OGPDXONMPVDODU-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H15N3O/c14-7-8-2-3-9(6-8)13-10-11-4-1-5-12-10/h1,4-5,8-9,14H,2-3,6-7H2,(H,11,12,13)/t8-,9-/m1/s1.
What are the key properties of [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol?
[(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol has a molecular weight of 193.25 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3R)-3-(pyrimidin-2-ylamino)cyclopentyl]methanol is sourced from PubChem (CID 57162301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).