C13H26OSi — CID 57162606
[(4R)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane (PubChem CID 57162606) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is [(4R)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane.
| Compound Name | [(4R)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 57162606 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | [(4R)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane |
| SMILES | CC12CCCC1[C@H](O[Si](C)(C)C)CCC2 |
| InChI | InChI=1S/C13H26OSi/c1-13-9-5-7-11(13)12(8-6-10-13)14-15(2,3)4/h11-12H,5-10H2,1-4H3/t11?,12-,13?/m1/s1 |
| InChIKey | RJLZQJQJARXCKY-OTTFEQOBSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|