About 2-pentoxypropanal
2-pentoxypropanal (PubChem CID 57162650) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2-pentoxypropanal.
Molecular Properties
| Compound Name | 2-pentoxypropanal |
| PubChem CID | 57162650 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2-pentoxypropanal |
| SMILES | CCCCCOC(C)C=O |
| InChI | InChI=1S/C8H16O2/c1-3-4-5-6-10-8(2)7-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZQLRBBXHIOENGE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentoxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentoxypropanal?
The IUPAC name of 2-pentoxypropanal (CID 57162650) is 2-pentoxypropanal.
What is the SMILES notation for 2-pentoxypropanal?
The canonical SMILES for 2-pentoxypropanal is CCCCCOC(C)C=O.
What is the InChIKey of 2-pentoxypropanal?
The InChIKey is ZQLRBBXHIOENGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-4-5-6-10-8(2)7-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-pentoxypropanal?
2-pentoxypropanal has a molecular weight of 144.21 g/mol, XLogP of 1.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentoxypropanal is sourced from PubChem (CID 57162650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).