C20H31N3O6SSi — CID 57162656
prop-2-enyl (4S)-4-acetylsulfanyl-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-diazo-3-oxobutanoate (PubChem CID 57162656) has the molecular formula C20H31N3O6SSi and a molecular weight of 469.64 g/mol. Its IUPAC name is prop-2-enyl (4S)-4-acetylsulfanyl-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-diazo-3-oxobutanoate.
| Compound Name | prop-2-enyl (4S)-4-acetylsulfanyl-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-diazo-3-oxobutanoate |
|---|---|
| PubChem CID | 57162656 |
| Molecular Formula | C20H31N3O6SSi |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | prop-2-enyl (4S)-4-acetylsulfanyl-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-diazo-3-oxobutanoate |
| SMILES | C=CCOC(=O)C(=[N+]=[N-])C(=O)[C@@H](SC(C)=O)[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H31N3O6SSi/c1-9-10-28-19(27)15(23-21)16(25)17(30-12(3)24)14-13(18(26)22-14)11(2)29-31(7,8)20(4,5)6/h9,11,13-14,17H,1,10H2,2-8H3,(H,22,26)/t11-,13-,14+,17+/m1/s1 |
| InChIKey | CSKZSGUOSLESJJ-CVGURMSBSA-N |
| XLogP | 2.13 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|