C22H31N5O2S — CID 57162667
(4S)-N-(2-methyl-4-nitrophenyl)-3-(2-methylpropyl)-4-[[5-(2-methylpropyl)-1H-imidazol-2-yl]methyl]-1,3-thiazolidin-2-imine (PubChem CID 57162667) has the molecular formula C22H31N5O2S and a molecular weight of 429.59 g/mol. Its IUPAC name is (4S)-N-(2-methyl-4-nitrophenyl)-3-(2-methylpropyl)-4-[[5-(2-methylpropyl)-1H-imidazol-2-yl]methyl]-1,3-thiazolidin-2-imine.
| Compound Name | (4S)-N-(2-methyl-4-nitrophenyl)-3-(2-methylpropyl)-4-[[5-(2-methylpropyl)-1H-imidazol-2-yl]methyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 57162667 |
| Molecular Formula | C22H31N5O2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (4S)-N-(2-methyl-4-nitrophenyl)-3-(2-methylpropyl)-4-[[5-(2-methylpropyl)-1H-imidazol-2-yl]methyl]-1,3-thiazolidin-2-imine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1/N=C1\SC[C@H](Cc2ncc(CC(C)C)[nH]2)N1CC(C)C |
| InChI | InChI=1S/C22H31N5O2S/c1-14(2)8-17-11-23-21(24-17)10-19-13-30-22(26(19)12-15(3)4)25-20-7-6-18(27(28)29)9-16(20)5/h6-7,9,11,14-15,19H,8,10,12-13H2,1-5H3,(H,23,24)/b25-22-/t19-/m0/s1 |
| InChIKey | BUFMRYZJXLENPE-NWIBBQCFSA-N |
| XLogP | 5.13 |
| TPSA | 87.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|