About 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite
1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite (PubChem CID 57162676) has the molecular formula C16H19NO4S
and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite.
Molecular Properties
| Compound Name | 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite |
| PubChem CID | 57162676 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(C)OS(=O)O)C(=O)CCC1 |
| InChI | InChI=1S/C16H19NO4S/c1-10-6-7-14-13(8-10)12-4-3-5-15(18)16(12)17(14)9-11(2)21-22(19)20/h6-8,11H,3-5,9H2,1-2H3,(H,19,20) |
| InChIKey | SXMRDVDJDRXNCY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite?
The IUPAC name of 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite (CID 57162676) is 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite.
What is the SMILES notation for 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite?
The canonical SMILES for 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite is Cc1ccc2c(c1)c1c(n2CC(C)OS(=O)O)C(=O)CCC1.
What is the InChIKey of 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite?
The InChIKey is SXMRDVDJDRXNCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4S/c1-10-6-7-14-13(8-10)12-4-3-5-15(18)16(12)17(14)9-11(2)21-22(19)20/h6-8,11H,3-5,9H2,1-2H3,(H,19,20).
What are the key properties of 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite?
1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite has a molecular weight of 321.40 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methyl-1-oxo-3,4-dihydro-2H-carbazol-9-yl)propan-2-yl hydrogen sulfite is sourced from PubChem (CID 57162676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).