C16H22O6 — CID 57162924
4-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-methyl-4-prop-2-enoylocta-1,7-diene-3,6-dione (PubChem CID 57162924) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-methyl-4-prop-2-enoylocta-1,7-diene-3,6-dione.
| Compound Name | 4-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-methyl-4-prop-2-enoylocta-1,7-diene-3,6-dione |
|---|---|
| PubChem CID | 57162924 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-methyl-4-prop-2-enoylocta-1,7-diene-3,6-dione |
| SMILES | C=CC(=O)C(C)C(C(=O)C=C)(C(=O)C=C)C(CO)(CO)CO |
| InChI | InChI=1S/C16H22O6/c1-5-12(20)11(4)16(13(21)6-2,14(22)7-3)15(8-17,9-18)10-19/h5-7,11,17-19H,1-3,8-10H2,4H3 |
| InChIKey | CPIOLJHQACESAA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|