About 2-sulfanylbut-3-en-1-ol
2-sulfanylbut-3-en-1-ol (PubChem CID 57162949) has the molecular formula C4H8OS
and a molecular weight of 104.17 g/mol. Its IUPAC name is 2-sulfanylbut-3-en-1-ol.
Molecular Properties
| Compound Name | 2-sulfanylbut-3-en-1-ol |
| PubChem CID | 57162949 |
| Molecular Formula | C4H8OS |
| Molecular Weight | 104.17 g/mol |
| Exact Mass | 104.03 |
| IUPAC Name | 2-sulfanylbut-3-en-1-ol |
| SMILES | C=CC(S)CO |
| InChI | InChI=1S/C4H8OS/c1-2-4(6)3-5/h2,4-6H,1,3H2 |
| InChIKey | YVWQBWHXISJROG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylbut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylbut-3-en-1-ol?
The IUPAC name of 2-sulfanylbut-3-en-1-ol (CID 57162949) is 2-sulfanylbut-3-en-1-ol.
What is the SMILES notation for 2-sulfanylbut-3-en-1-ol?
The canonical SMILES for 2-sulfanylbut-3-en-1-ol is C=CC(S)CO.
What is the InChIKey of 2-sulfanylbut-3-en-1-ol?
The InChIKey is YVWQBWHXISJROG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8OS/c1-2-4(6)3-5/h2,4-6H,1,3H2.
What are the key properties of 2-sulfanylbut-3-en-1-ol?
2-sulfanylbut-3-en-1-ol has a molecular weight of 104.17 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylbut-3-en-1-ol is sourced from PubChem (CID 57162949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).