C8H6N2O2 — CID 57163255
1H-pyrrolo[2,3-b]pyridin-3-yl formate (PubChem CID 57163255) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridin-3-yl formate.
| Compound Name | 1H-pyrrolo[2,3-b]pyridin-3-yl formate |
|---|---|
| PubChem CID | 57163255 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1H-pyrrolo[2,3-b]pyridin-3-yl formate |
| SMILES | O=COc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C8H6N2O2/c11-5-12-7-4-10-8-6(7)2-1-3-9-8/h1-5H,(H,9,10) |
| InChIKey | FDCOMXQVGJERCR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|