About 1H-pyrrolo[2,3-b]pyridin-3-yl formate
1H-pyrrolo[2,3-b]pyridin-3-yl formate (PubChem CID 57163255) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridin-3-yl formate.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-b]pyridin-3-yl formate |
| PubChem CID | 57163255 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1H-pyrrolo[2,3-b]pyridin-3-yl formate |
| SMILES | O=COc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C8H6N2O2/c11-5-12-7-4-10-8-6(7)2-1-3-9-8/h1-5H,(H,9,10) |
| InChIKey | FDCOMXQVGJERCR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[2,3-b]pyridin-3-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-b]pyridin-3-yl formate?
The IUPAC name of 1H-pyrrolo[2,3-b]pyridin-3-yl formate (CID 57163255) is 1H-pyrrolo[2,3-b]pyridin-3-yl formate.
What is the SMILES notation for 1H-pyrrolo[2,3-b]pyridin-3-yl formate?
The canonical SMILES for 1H-pyrrolo[2,3-b]pyridin-3-yl formate is O=COc1c[nH]c2ncccc12.
What is the InChIKey of 1H-pyrrolo[2,3-b]pyridin-3-yl formate?
The InChIKey is FDCOMXQVGJERCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-5-12-7-4-10-8-6(7)2-1-3-9-8/h1-5H,(H,9,10).
What are the key properties of 1H-pyrrolo[2,3-b]pyridin-3-yl formate?
1H-pyrrolo[2,3-b]pyridin-3-yl formate has a molecular weight of 162.15 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-b]pyridin-3-yl formate is sourced from PubChem (CID 57163255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).