C24H37NO2 — CID 57163421
(8S,9R,10R,13S,14S)-N,N-diethyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 57163421) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-N,N-diethyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (8S,9R,10R,13S,14S)-N,N-diethyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 57163421 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (8S,9R,10R,13S,14S)-N,N-diethyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CCN(CC)C(=O)C1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C24H37NO2/c1-5-25(6-2)22(27)21-10-9-19-18-8-7-16-15-17(26)11-13-23(16,3)20(18)12-14-24(19,21)4/h15,18-21H,5-14H2,1-4H3/t18-,19-,20+,21?,23-,24-/m0/s1 |
| InChIKey | VWUSEJQEGXLXIO-JXPZMUTJSA-N |
| XLogP | 5.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |