C24H32O2 — CID 57163744
2-(1,1-diphenylethyl)-3,7-dimethyloct-6-ene-1,1-diol (PubChem CID 57163744) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-(1,1-diphenylethyl)-3,7-dimethyloct-6-ene-1,1-diol.
| Compound Name | 2-(1,1-diphenylethyl)-3,7-dimethyloct-6-ene-1,1-diol |
|---|---|
| PubChem CID | 57163744 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-(1,1-diphenylethyl)-3,7-dimethyloct-6-ene-1,1-diol |
| SMILES | CC(C)=CCCC(C)C(C(O)O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O2/c1-18(2)12-11-13-19(3)22(23(25)26)24(4,20-14-7-5-8-15-20)21-16-9-6-10-17-21/h5-10,12,14-17,19,22-23,25-26H,11,13H2,1-4H3 |
| InChIKey | PCPPQCQOMFMTEK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|