C22H21FO3S — CID 57164008
S-[(2S,4R)-2-[2-[2-[(4-fluorophenyl)methyl]phenyl]ethenyl]-6-oxooxan-4-yl] ethanethioate (PubChem CID 57164008) has the molecular formula C22H21FO3S and a molecular weight of 384.47 g/mol. Its IUPAC name is S-[(2S,4R)-2-[2-[2-[(4-fluorophenyl)methyl]phenyl]ethenyl]-6-oxooxan-4-yl] ethanethioate.
| Compound Name | S-[(2S,4R)-2-[2-[2-[(4-fluorophenyl)methyl]phenyl]ethenyl]-6-oxooxan-4-yl] ethanethioate |
|---|---|
| PubChem CID | 57164008 |
| Molecular Formula | C22H21FO3S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | S-[(2S,4R)-2-[2-[2-[(4-fluorophenyl)methyl]phenyl]ethenyl]-6-oxooxan-4-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1CC(=O)O[C@H](C=Cc2ccccc2Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H21FO3S/c1-15(24)27-21-13-20(26-22(25)14-21)11-8-17-4-2-3-5-18(17)12-16-6-9-19(23)10-7-16/h2-11,20-21H,12-14H2,1H3/t20-,21-/m1/s1 |
| InChIKey | NZUSBHUXACBJLU-NHCUHLMSSA-N |
| XLogP | 4.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|