C17H18F3NO2S — CID 57164209
ethyl 2-methanethioyl-6-methyl-4-[2-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydropyridine-3-carboxylate (PubChem CID 57164209) has the molecular formula C17H18F3NO2S and a molecular weight of 357.40 g/mol. Its IUPAC name is ethyl 2-methanethioyl-6-methyl-4-[2-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydropyridine-3-carboxylate.
| Compound Name | ethyl 2-methanethioyl-6-methyl-4-[2-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 57164209 |
| Molecular Formula | C17H18F3NO2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | ethyl 2-methanethioyl-6-methyl-4-[2-(trifluoromethyl)phenyl]-2,3,4,5-tetrahydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1C(C=S)N=C(C)CC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO2S/c1-3-23-16(22)15-12(8-10(2)21-14(15)9-24)11-6-4-5-7-13(11)17(18,19)20/h4-7,9,12,14-15H,3,8H2,1-2H3 |
| InChIKey | RIQDALWGVKIRPZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|