C19H36N2 — CID 57164561
N,N',N'-tricyclohexylmethanediamine (PubChem CID 57164561) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is N,N',N'-tricyclohexylmethanediamine.
| Compound Name | N,N',N'-tricyclohexylmethanediamine |
|---|---|
| PubChem CID | 57164561 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | N,N',N'-tricyclohexylmethanediamine |
| SMILES | C1CCC(NCN(C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H36N2/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h17-20H,1-16H2 |
| InChIKey | KTDXFABIFMPFQZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|