C13H11BrN2O2S — CID 57164650
4-[(4-bromo-1-methoxynaphthalen-2-yl)methyl]-3H-1,2,3,5-oxathiadiazole (PubChem CID 57164650) has the molecular formula C13H11BrN2O2S and a molecular weight of 339.21 g/mol. Its IUPAC name is 4-[(4-bromo-1-methoxynaphthalen-2-yl)methyl]-3H-1,2,3,5-oxathiadiazole.
| Compound Name | 4-[(4-bromo-1-methoxynaphthalen-2-yl)methyl]-3H-1,2,3,5-oxathiadiazole |
|---|---|
| PubChem CID | 57164650 |
| Molecular Formula | C13H11BrN2O2S |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 4-[(4-bromo-1-methoxynaphthalen-2-yl)methyl]-3H-1,2,3,5-oxathiadiazole |
| SMILES | COc1c(CC2=NOSN2)cc(Br)c2ccccc12 |
| InChI | InChI=1S/C13H11BrN2O2S/c1-17-13-8(7-12-15-18-19-16-12)6-11(14)9-4-2-3-5-10(9)13/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | YQUGLPIUSXKAMJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|