About [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid
[[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid (PubChem CID 57164687) has the molecular formula C11H22N3O3PS
and a molecular weight of 307.36 g/mol. Its IUPAC name is [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid.
Molecular Properties
| Compound Name | [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid |
| PubChem CID | 57164687 |
| Molecular Formula | C11H22N3O3PS |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid |
| SMILES | CCN(CC)c1nc(C)cc(S(C)(C)P(=O)(O)O)n1 |
| InChI | InChI=1S/C11H22N3O3PS/c1-6-14(7-2)11-12-9(3)8-10(13-11)19(4,5)18(15,16)17/h8H,6-7H2,1-5H3,(H2,15,16,17) |
| InChIKey | HUSVZQKTICGYEQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid?
The IUPAC name of [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid (CID 57164687) is [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid.
What is the SMILES notation for [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid?
The canonical SMILES for [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid is CCN(CC)c1nc(C)cc(S(C)(C)P(=O)(O)O)n1.
What is the InChIKey of [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid?
The InChIKey is HUSVZQKTICGYEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N3O3PS/c1-6-14(7-2)11-12-9(3)8-10(13-11)19(4,5)18(15,16)17/h8H,6-7H2,1-5H3,(H2,15,16,17).
What are the key properties of [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid?
[[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid has a molecular weight of 307.36 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(diethylamino)-6-methylpyrimidin-4-yl]-dimethyl-λ4-sulfanyl]phosphonic acid is sourced from PubChem (CID 57164687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).