C15H14O3 — CID 57164696
[(1R,2R,4S,5R)-4-naphthalen-1-yl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol (PubChem CID 57164696) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is [(1R,2R,4S,5R)-4-naphthalen-1-yl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol.
| Compound Name | [(1R,2R,4S,5R)-4-naphthalen-1-yl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol |
|---|---|
| PubChem CID | 57164696 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [(1R,2R,4S,5R)-4-naphthalen-1-yl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol |
| SMILES | OC[C@H]1O[C@@H](c2cccc3ccccc23)[C@H]2O[C@@H]21 |
| InChI | InChI=1S/C15H14O3/c16-8-12-14-15(18-14)13(17-12)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-16H,8H2/t12-,13+,14-,15-/m1/s1 |
| InChIKey | GWTDRSKBBGFWPA-LXTVHRRPSA-N |
| XLogP | 2.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|