C31H38N2O9 — CID 57164724
10-(butylamino)-23-(dimethylamino)-4,8,12,22,24-pentahydroxy-1,12-dimethyl-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2,4,7(16),8,14,18-hexaene-6,17-dione (PubChem CID 57164724) has the molecular formula C31H38N2O9 and a molecular weight of 582.65 g/mol. Its IUPAC name is 10-(butylamino)-23-(dimethylamino)-4,8,12,22,24-pentahydroxy-1,12-dimethyl-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2,4,7(16),8,14,18-hexaene-6,17-dione.
| Compound Name | 10-(butylamino)-23-(dimethylamino)-4,8,12,22,24-pentahydroxy-1,12-dimethyl-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2,4,7(16),8,14,18-hexaene-6,17-dione |
|---|---|
| PubChem CID | 57164724 |
| Molecular Formula | C31H38N2O9 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | 10-(butylamino)-23-(dimethylamino)-4,8,12,22,24-pentahydroxy-1,12-dimethyl-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2,4,7(16),8,14,18-hexaene-6,17-dione |
| SMILES | CCCCNC1CC(C)(O)Cc2cc3c(c(O)c21)C(=O)c1c(O)cc2c(c1C3=O)OC1OC2(C)C(O)C(N(C)C)C1O |
| InChI | InChI=1S/C31H38N2O9/c1-6-7-8-32-16-12-30(2,40)11-13-9-14-19(24(36)18(13)16)25(37)20-17(34)10-15-27(21(20)23(14)35)41-29-26(38)22(33(4)5)28(39)31(15,3)42-29/h9-10,16,22,26,28-29,32,34,36,38-40H,6-8,11-12H2,1-5H3 |
| InChIKey | QSINFCSDKRWVRN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 169.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|