C14H18N2O2 — CID 57164746
4-[(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methyl]morpholine (PubChem CID 57164746) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-[(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methyl]morpholine.
| Compound Name | 4-[(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methyl]morpholine |
|---|---|
| PubChem CID | 57164746 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-[(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methyl]morpholine |
| SMILES | C1=C(c2ccccc2)NOC1CN1CCOCC1 |
| InChI | InChI=1S/C14H18N2O2/c1-2-4-12(5-3-1)14-10-13(18-15-14)11-16-6-8-17-9-7-16/h1-5,10,13,15H,6-9,11H2 |
| InChIKey | FMYXLWPJAVQWBX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |