C17H27N3O4S — CID 57164787
(3aS,6R,6aR)-1-[4-(cyclopropylamino)but-2-enoyl]-4-methylsulfonyl-6-propan-2-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 57164787) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is (3aS,6R,6aR)-1-[4-(cyclopropylamino)but-2-enoyl]-4-methylsulfonyl-6-propan-2-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6R,6aR)-1-[4-(cyclopropylamino)but-2-enoyl]-4-methylsulfonyl-6-propan-2-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 57164787 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (3aS,6R,6aR)-1-[4-(cyclopropylamino)but-2-enoyl]-4-methylsulfonyl-6-propan-2-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | CC(C)[C@H]1C(=O)N(S(C)(=O)=O)[C@H]2CCN(C(=O)C=CCNC3CC3)[C@H]12 |
| InChI | InChI=1S/C17H27N3O4S/c1-11(2)15-16-13(20(17(15)22)25(3,23)24)8-10-19(16)14(21)5-4-9-18-12-6-7-12/h4-5,11-13,15-16,18H,6-10H2,1-3H3/t13-,15+,16-/m0/s1 |
| InChIKey | MWFUXOKATAAACM-IMJJTQAJSA-N |
| XLogP | 0.34 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|