About 3-cycloheptyl-2,5-dihydropyridine
3-cycloheptyl-2,5-dihydropyridine (PubChem CID 57165234) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-cycloheptyl-2,5-dihydropyridine.
Molecular Properties
| Compound Name | 3-cycloheptyl-2,5-dihydropyridine |
| PubChem CID | 57165234 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3-cycloheptyl-2,5-dihydropyridine |
| SMILES | C1=NCC(C2CCCCCC2)=CC1 |
| InChI | InChI=1S/C12H19N/c1-2-4-7-11(6-3-1)12-8-5-9-13-10-12/h8-9,11H,1-7,10H2 |
| InChIKey | MWOMGKRRVJYYIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-cycloheptyl-2,5-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cycloheptyl-2,5-dihydropyridine?
The IUPAC name of 3-cycloheptyl-2,5-dihydropyridine (CID 57165234) is 3-cycloheptyl-2,5-dihydropyridine.
What is the SMILES notation for 3-cycloheptyl-2,5-dihydropyridine?
The canonical SMILES for 3-cycloheptyl-2,5-dihydropyridine is C1=NCC(C2CCCCCC2)=CC1.
What is the InChIKey of 3-cycloheptyl-2,5-dihydropyridine?
The InChIKey is MWOMGKRRVJYYIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-2-4-7-11(6-3-1)12-8-5-9-13-10-12/h8-9,11H,1-7,10H2.
What are the key properties of 3-cycloheptyl-2,5-dihydropyridine?
3-cycloheptyl-2,5-dihydropyridine has a molecular weight of 177.29 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cycloheptyl-2,5-dihydropyridine is sourced from PubChem (CID 57165234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).