C15H20S — CID 57165344
2-benzyl-2,3,4,5,6,7-hexahydrothionine (PubChem CID 57165344) has the molecular formula C15H20S and a molecular weight of 232.39 g/mol. Its IUPAC name is 2-benzyl-2,3,4,5,6,7-hexahydrothionine.
| Compound Name | 2-benzyl-2,3,4,5,6,7-hexahydrothionine |
|---|---|
| PubChem CID | 57165344 |
| Molecular Formula | C15H20S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-benzyl-2,3,4,5,6,7-hexahydrothionine |
| SMILES | C1=CSC(Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C15H20S/c1-2-7-11-15(16-12-8-3-1)13-14-9-5-4-6-10-14/h4-6,8-10,12,15H,1-3,7,11,13H2 |
| InChIKey | ICYNLOXOXITUTO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |