C19H36OSi — CID 57165414
butyl-[(5-ethylidene-4a-methyl-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl)oxy]-dimethylsilane (PubChem CID 57165414) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is butyl-[(5-ethylidene-4a-methyl-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl)oxy]-dimethylsilane.
| Compound Name | butyl-[(5-ethylidene-4a-methyl-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 57165414 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | butyl-[(5-ethylidene-4a-methyl-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl)oxy]-dimethylsilane |
| SMILES | CC=C1CCCC2C(O[Si](C)(C)CCCC)CCCC12C |
| InChI | InChI=1S/C19H36OSi/c1-6-8-15-21(4,5)20-18-13-10-14-19(3)16(7-2)11-9-12-17(18)19/h7,17-18H,6,8-15H2,1-5H3 |
| InChIKey | HINHFZAFUGGQQA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|