About 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid
3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid (PubChem CID 57165743) has the molecular formula C22H24N2O2S
and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid |
| PubChem CID | 57165743 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]cc(CCCCN3CC=C(c4cccs4)CC3)c2c1 |
| InChI | InChI=1S/C22H24N2O2S/c25-22(26)17-6-7-20-19(14-17)18(15-23-20)4-1-2-10-24-11-8-16(9-12-24)21-5-3-13-27-21/h3,5-8,13-15,23H,1-2,4,9-12H2,(H,25,26) |
| InChIKey | DVSWBJHXHOYVQZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid?
The IUPAC name of 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid (CID 57165743) is 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid.
What is the SMILES notation for 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid?
The canonical SMILES for 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid is O=C(O)c1ccc2[nH]cc(CCCCN3CC=C(c4cccs4)CC3)c2c1.
What is the InChIKey of 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid?
The InChIKey is DVSWBJHXHOYVQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2S/c25-22(26)17-6-7-20-19(14-17)18(15-23-20)4-1-2-10-24-11-8-16(9-12-24)21-5-3-13-27-21/h3,5-8,13-15,23H,1-2,4,9-12H2,(H,25,26).
What are the key properties of 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid?
3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid has a molecular weight of 380.51 g/mol, XLogP of 5.04, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-5-carboxylic acid is sourced from PubChem (CID 57165743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).