About cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate
cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate (PubChem CID 57165775) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate |
| PubChem CID | 57165775 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OC1=CCCC1)C1=CCCC1 |
| InChI | InChI=1S/C13H16O2/c1-10(11-6-2-3-7-11)13(14)15-12-8-4-5-9-12/h6,8H,1-5,7,9H2 |
| InChIKey | HHNVJDSLBWUVLK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate?
The IUPAC name of cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate (CID 57165775) is cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate.
What is the SMILES notation for cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate?
The canonical SMILES for cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate is C=C(C(=O)OC1=CCCC1)C1=CCCC1.
What is the InChIKey of cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate?
The InChIKey is HHNVJDSLBWUVLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-10(11-6-2-3-7-11)13(14)15-12-8-4-5-9-12/h6,8H,1-5,7,9H2.
What are the key properties of cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate?
cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate has a molecular weight of 204.27 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl 2-(cyclopenten-1-yl)prop-2-enoate is sourced from PubChem (CID 57165775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).