C29H42O2 — CID 57165899
2-(13,13-diethoxy-3,7,12-trimethyltrideca-1,3,5,7,11-pentaen-9-ynyl)-1,3,3-trimethylcyclohexene (PubChem CID 57165899) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is 2-(13,13-diethoxy-3,7,12-trimethyltrideca-1,3,5,7,11-pentaen-9-ynyl)-1,3,3-trimethylcyclohexene.
| Compound Name | 2-(13,13-diethoxy-3,7,12-trimethyltrideca-1,3,5,7,11-pentaen-9-ynyl)-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 57165899 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 2-(13,13-diethoxy-3,7,12-trimethyltrideca-1,3,5,7,11-pentaen-9-ynyl)-1,3,3-trimethylcyclohexene |
| SMILES | CCOC(OCC)C(C)=CC#CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C29H42O2/c1-9-30-28(31-10-2)26(6)18-12-11-15-23(3)16-13-17-24(4)20-21-27-25(5)19-14-22-29(27,7)8/h13,15-18,20-21,28H,9-10,14,19,22H2,1-8H3 |
| InChIKey | DDQWVXPXXCLMDB-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|