About 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one
3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one (PubChem CID 57166036) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one |
| PubChem CID | 57166036 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one |
| SMILES | O=C1C=C(C2=COC=CO2)CCC1 |
| InChI | InChI=1S/C10H10O3/c11-9-3-1-2-8(6-9)10-7-12-4-5-13-10/h4-7H,1-3H2 |
| InChIKey | BXAULVJESAPFBC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one?
The IUPAC name of 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one (CID 57166036) is 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one.
What is the SMILES notation for 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one?
The canonical SMILES for 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one is O=C1C=C(C2=COC=CO2)CCC1.
What is the InChIKey of 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one?
The InChIKey is BXAULVJESAPFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-9-3-1-2-8(6-9)10-7-12-4-5-13-10/h4-7H,1-3H2.
What are the key properties of 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one?
3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one has a molecular weight of 178.19 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dioxin-2-yl)cyclohex-2-en-1-one is sourced from PubChem (CID 57166036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).