C10H10N6O — CID 57167634
1-isocyanato-6-phenyl-2H-1,3,5-triazine-2,4-diamine (PubChem CID 57167634) has the molecular formula C10H10N6O and a molecular weight of 230.23 g/mol. Its IUPAC name is 1-isocyanato-6-phenyl-2H-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-isocyanato-6-phenyl-2H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 57167634 |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-isocyanato-6-phenyl-2H-1,3,5-triazine-2,4-diamine |
| SMILES | NC1=NC(N)N(N=C=O)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C10H10N6O/c11-9-14-8(7-4-2-1-3-5-7)16(13-6-17)10(12)15-9/h1-5,10H,12H2,(H2,11,15) |
| InChIKey | BYHXSPDINAYCFC-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|