About 4-(1,3-dioxetan-2-yl)phenol
4-(1,3-dioxetan-2-yl)phenol (PubChem CID 57167752) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 4-(1,3-dioxetan-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(1,3-dioxetan-2-yl)phenol |
| PubChem CID | 57167752 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 4-(1,3-dioxetan-2-yl)phenol |
| SMILES | Oc1ccc(C2OCO2)cc1 |
| InChI | InChI=1S/C8H8O3/c9-7-3-1-6(2-4-7)8-10-5-11-8/h1-4,8-9H,5H2 |
| InChIKey | SNIHHRUYVRXZJZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-dioxetan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxetan-2-yl)phenol?
The IUPAC name of 4-(1,3-dioxetan-2-yl)phenol (CID 57167752) is 4-(1,3-dioxetan-2-yl)phenol.
What is the SMILES notation for 4-(1,3-dioxetan-2-yl)phenol?
The canonical SMILES for 4-(1,3-dioxetan-2-yl)phenol is Oc1ccc(C2OCO2)cc1.
What is the InChIKey of 4-(1,3-dioxetan-2-yl)phenol?
The InChIKey is SNIHHRUYVRXZJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c9-7-3-1-6(2-4-7)8-10-5-11-8/h1-4,8-9H,5H2.
What are the key properties of 4-(1,3-dioxetan-2-yl)phenol?
4-(1,3-dioxetan-2-yl)phenol has a molecular weight of 152.15 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxetan-2-yl)phenol is sourced from PubChem (CID 57167752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).