About 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol
2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol (PubChem CID 57167775) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol.
Molecular Properties
| Compound Name | 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol |
| PubChem CID | 57167775 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1Cc1ccccc1)CCC2 |
| InChI | InChI=1S/C14H15NO2/c16-13-11-7-4-8-12(11)14(17)15(13)9-10-5-2-1-3-6-10/h1-3,5-6,16-17H,4,7-9H2 |
| InChIKey | WHWMPMOHMPDSOE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol?
The IUPAC name of 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol (CID 57167775) is 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol.
What is the SMILES notation for 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol?
The canonical SMILES for 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol is Oc1c2c(c(O)n1Cc1ccccc1)CCC2.
What is the InChIKey of 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol?
The InChIKey is WHWMPMOHMPDSOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c16-13-11-7-4-8-12(11)14(17)15(13)9-10-5-2-1-3-6-10/h1-3,5-6,16-17H,4,7-9H2.
What are the key properties of 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol?
2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol has a molecular weight of 229.28 g/mol, XLogP of 2.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-diol is sourced from PubChem (CID 57167775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).