C20H22ClFN2O4S — CID 57167798
diethylamino 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]sulfanylacetate (PubChem CID 57167798) has the molecular formula C20H22ClFN2O4S and a molecular weight of 440.92 g/mol. Its IUPAC name is diethylamino 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]sulfanylacetate.
| Compound Name | diethylamino 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 57167798 |
| Molecular Formula | C20H22ClFN2O4S |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | diethylamino 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]sulfanylacetate |
| SMILES | CCN(CC)OC(=O)CSc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C20H22ClFN2O4S/c1-3-23(4-2)28-18(25)11-29-17-10-16(15(22)9-14(17)21)24-19(26)12-7-5-6-8-13(12)20(24)27/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | FJBYBFDMKAXQDD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|