C38H51N3O7 — CID 57168101
1-O-[(3S)-1-amino-6-nonoxy-1-oxohexan-3-yl] 6-O-benzyl (2S)-2-(quinoline-2-carbonylamino)hexanedioate (PubChem CID 57168101) has the molecular formula C38H51N3O7 and a molecular weight of 661.84 g/mol. Its IUPAC name is 1-O-[(3S)-1-amino-6-nonoxy-1-oxohexan-3-yl] 6-O-benzyl (2S)-2-(quinoline-2-carbonylamino)hexanedioate.
| Compound Name | 1-O-[(3S)-1-amino-6-nonoxy-1-oxohexan-3-yl] 6-O-benzyl (2S)-2-(quinoline-2-carbonylamino)hexanedioate |
|---|---|
| PubChem CID | 57168101 |
| Molecular Formula | C38H51N3O7 |
| Molecular Weight | 661.84 g/mol |
| Exact Mass | 661.37 |
| IUPAC Name | 1-O-[(3S)-1-amino-6-nonoxy-1-oxohexan-3-yl] 6-O-benzyl (2S)-2-(quinoline-2-carbonylamino)hexanedioate |
| SMILES | CCCCCCCCCOCCC[C@@H](CC(N)=O)OC(=O)[C@H](CCCC(=O)OCc1ccccc1)NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C38H51N3O7/c1-2-3-4-5-6-7-13-25-46-26-15-19-31(27-35(39)42)48-38(45)34(21-14-22-36(43)47-28-29-16-9-8-10-17-29)41-37(44)33-24-23-30-18-11-12-20-32(30)40-33/h8-12,16-18,20,23-24,31,34H,2-7,13-15,19,21-22,25-28H2,1H3,(H2,39,42)(H,41,44)/t31-,34-/m0/s1 |
| InChIKey | CHWHVCABSZOGFC-VBTAUBHQSA-N |
| XLogP | 6.58 |
| TPSA | 146.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.84 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|