C25H46O7Si — CID 57168287
6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-3-(methoxymethoxy)-2,4-dimethylhex-4-enoic acid (PubChem CID 57168287) has the molecular formula C25H46O7Si and a molecular weight of 486.72 g/mol. Its IUPAC name is 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-3-(methoxymethoxy)-2,4-dimethylhex-4-enoic acid.
| Compound Name | 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-3-(methoxymethoxy)-2,4-dimethylhex-4-enoic acid |
|---|---|
| PubChem CID | 57168287 |
| Molecular Formula | C25H46O7Si |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-3-(methoxymethoxy)-2,4-dimethylhex-4-enoic acid |
| SMILES | COCOC(C(C)=CCC1CC(O[Si](C)(C)C(C)(C)C)CC2(CCCCO2)O1)C(C)C(=O)O |
| InChI | InChI=1S/C25H46O7Si/c1-18(22(29-17-28-6)19(2)23(26)27)11-12-20-15-21(32-33(7,8)24(3,4)5)16-25(31-20)13-9-10-14-30-25/h11,19-22H,9-10,12-17H2,1-8H3,(H,26,27) |
| InChIKey | JNQZXOCPKNJMQS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|