C13H18O — CID 57168372
1-(2,6,6-trimethylcyclohexa-2,4-dien-1-yl)but-2-en-1-one (PubChem CID 57168372) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-(2,6,6-trimethylcyclohexa-2,4-dien-1-yl)but-2-en-1-one.
| Compound Name | 1-(2,6,6-trimethylcyclohexa-2,4-dien-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 57168372 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-(2,6,6-trimethylcyclohexa-2,4-dien-1-yl)but-2-en-1-one |
| SMILES | CC=CC(=O)C1C(C)=CC=CC1(C)C |
| InChI | InChI=1S/C13H18O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5-9,12H,1-4H3 |
| InChIKey | JGBBQKAJVHEQJM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|