C32H52O2Si — CID 57168444
4,6,11,14-tetratert-butyl-9,9,16-trimethyl-8,10-dioxa-9-silatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13-pentaene (PubChem CID 57168444) has the molecular formula C32H52O2Si and a molecular weight of 496.85 g/mol. Its IUPAC name is 4,6,11,14-tetratert-butyl-9,9,16-trimethyl-8,10-dioxa-9-silatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13-pentaene.
| Compound Name | 4,6,11,14-tetratert-butyl-9,9,16-trimethyl-8,10-dioxa-9-silatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13-pentaene |
|---|---|
| PubChem CID | 57168444 |
| Molecular Formula | C32H52O2Si |
| Molecular Weight | 496.85 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | 4,6,11,14-tetratert-butyl-9,9,16-trimethyl-8,10-dioxa-9-silatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13-pentaene |
| SMILES | CC1CC(C(C)(C)C)=CC2=C(C(C)(C)C)O[Si](C)(C)OC3C(C(C)(C)C)=CC(C(C)(C)C)=CC3=C21 |
| InChI | InChI=1S/C32H52O2Si/c1-20-16-21(29(2,3)4)18-24-26(20)23-17-22(30(5,6)7)19-25(31(8,9)10)27(23)33-35(14,15)34-28(24)32(11,12)13/h17-20,27H,16H2,1-15H3 |
| InChIKey | NKTHXOGEZCWJPK-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.85 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|