C22H27NO2 — CID 57168496
[4-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)phenyl] 2,2-dimethylpropanoate (PubChem CID 57168496) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is [4-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57168496 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | [4-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(NCC2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C22H27NO2/c1-22(2,3)21(24)25-20-12-10-19(11-13-20)23-15-16-8-9-17-6-4-5-7-18(17)14-16/h4-7,10-13,16,23H,8-9,14-15H2,1-3H3 |
| InChIKey | KBSHWXYZOIGYJH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|