C34H30Cl2N2O6 — CID 57168937
bis[5-(4-chlorophenoxy)-1,2,3,4-tetrahydro-3-benzazepin-5-yl] oxalate (PubChem CID 57168937) has the molecular formula C34H30Cl2N2O6 and a molecular weight of 633.53 g/mol. Its IUPAC name is bis[5-(4-chlorophenoxy)-1,2,3,4-tetrahydro-3-benzazepin-5-yl] oxalate.
| Compound Name | bis[5-(4-chlorophenoxy)-1,2,3,4-tetrahydro-3-benzazepin-5-yl] oxalate |
|---|---|
| PubChem CID | 57168937 |
| Molecular Formula | C34H30Cl2N2O6 |
| Molecular Weight | 633.53 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | bis[5-(4-chlorophenoxy)-1,2,3,4-tetrahydro-3-benzazepin-5-yl] oxalate |
| SMILES | O=C(OC1(Oc2ccc(Cl)cc2)CNCCc2ccccc21)C(=O)OC1(Oc2ccc(Cl)cc2)CNCCc2ccccc21 |
| InChI | InChI=1S/C34H30Cl2N2O6/c35-25-9-13-27(14-10-25)41-33(21-37-19-17-23-5-1-3-7-29(23)33)43-31(39)32(40)44-34(42-28-15-11-26(36)12-16-28)22-38-20-18-24-6-2-4-8-30(24)34/h1-16,37-38H,17-22H2 |
| InChIKey | NFKDUZQYUAMIOI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|