C15H19NO9 — CID 57169203
methyl (1R,2R,4S,6S,10S)-2-(methoxycarbonyloxymethyl)-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate (PubChem CID 57169203) has the molecular formula C15H19NO9 and a molecular weight of 357.32 g/mol. Its IUPAC name is methyl (1R,2R,4S,6S,10S)-2-(methoxycarbonyloxymethyl)-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate.
| Compound Name | methyl (1R,2R,4S,6S,10S)-2-(methoxycarbonyloxymethyl)-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate |
|---|---|
| PubChem CID | 57169203 |
| Molecular Formula | C15H19NO9 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl (1R,2R,4S,6S,10S)-2-(methoxycarbonyloxymethyl)-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate |
| SMILES | CNC(=O)O[C@@H]1OC=C(C(=O)OC)[C@H]2C[C@@H]3O[C@@]3(COC(=O)OC)[C@H]12 |
| InChI | InChI=1S/C15H19NO9/c1-16-13(18)24-12-10-7(8(5-22-12)11(17)20-2)4-9-15(10,25-9)6-23-14(19)21-3/h5,7,9-10,12H,4,6H2,1-3H3,(H,16,18)/t7-,9+,10+,12+,15-/m1/s1 |
| InChIKey | CGZDDIFZHSOGHO-LTMYSNNFSA-N |
| XLogP | 0.31 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|