C18H34O3Si2 — CID 57169321
trans-(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]carbonyl]cyclobutan-1-one (PubChem CID 57169321) has the molecular formula C18H34O3Si2 and a molecular weight of 354.64 g/mol. Its IUPAC name is trans-(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]carbonyl]cyclobutan-1-one.
| Compound Name | trans-(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]carbonyl]cyclobutan-1-one |
|---|---|
| PubChem CID | 57169321 |
| Molecular Formula | C18H34O3Si2 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | trans-(2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]carbonyl]cyclobutan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)C(=O)[C@@H]1C(=O)C[C@@H]1C(=O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si2/c1-17(2,3)22(7,8)15(20)12-11-13(19)14(12)16(21)23(9,10)18(4,5)6/h12,14H,11H2,1-10H3/t12-,14-/m0/s1 |
| InChIKey | AEZAPKKCHDASDD-JSGCOSHPSA-N |
| XLogP | 4.43 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|