About methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate
methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 57169406) has the molecular formula C23H21F7O3
and a molecular weight of 478.40 g/mol. Its IUPAC name is methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate |
| PubChem CID | 57169406 |
| Molecular Formula | C23H21F7O3 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCC(OCCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21F7O3/c1-32-21(31)18-6-7-19(20(18)14-2-4-17(24)5-3-14)33-9-8-13-10-15(22(25,26)27)12-16(11-13)23(28,29)30/h2-5,10-12,18-20H,6-9H2,1H3 |
| InChIKey | UGPUFTPWAWFMQA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate?
The IUPAC name of methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate (CID 57169406) is methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate?
The canonical SMILES for methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate is COC(=O)C1CCC(OCCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccc(F)cc1.
What is the InChIKey of methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate?
The InChIKey is UGPUFTPWAWFMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F7O3/c1-32-21(31)18-6-7-19(20(18)14-2-4-17(24)5-3-14)33-9-8-13-10-15(22(25,26)27)12-16(11-13)23(28,29)30/h2-5,10-12,18-20H,6-9H2,1H3.
What are the key properties of methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate?
methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate has a molecular weight of 478.40 g/mol, XLogP of 6.16, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentane-1-carboxylate is sourced from PubChem (CID 57169406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).