C11H8F12O2 — CID 57169672
5,6,7,8,8,8-hexafluoro-2-methyl-5,7-bis(trifluoromethyl)oct-2-enoic acid (PubChem CID 57169672) has the molecular formula C11H8F12O2 and a molecular weight of 400.16 g/mol. Its IUPAC name is 5,6,7,8,8,8-hexafluoro-2-methyl-5,7-bis(trifluoromethyl)oct-2-enoic acid.
| Compound Name | 5,6,7,8,8,8-hexafluoro-2-methyl-5,7-bis(trifluoromethyl)oct-2-enoic acid |
|---|---|
| PubChem CID | 57169672 |
| Molecular Formula | C11H8F12O2 |
| Molecular Weight | 400.16 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 5,6,7,8,8,8-hexafluoro-2-methyl-5,7-bis(trifluoromethyl)oct-2-enoic acid |
| SMILES | CC(=CCC(F)(C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H8F12O2/c1-4(5(24)25)2-3-7(13,9(15,16)17)6(12)8(14,10(18,19)20)11(21,22)23/h2,6H,3H2,1H3,(H,24,25) |
| InChIKey | QEKFNUMIKUGKAN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.16 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|