C40H46FN3O7 — CID 57169803
(2S)-3-[2-[3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]-4-hydroxyphenyl]-2-[6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]hexanoylamino]propanoic acid (PubChem CID 57169803) has the molecular formula C40H46FN3O7 and a molecular weight of 699.82 g/mol. Its IUPAC name is (2S)-3-[2-[3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]-4-hydroxyphenyl]-2-[6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]hexanoylamino]propanoic acid.
| Compound Name | (2S)-3-[2-[3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]-4-hydroxyphenyl]-2-[6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]hexanoylamino]propanoic acid |
|---|---|
| PubChem CID | 57169803 |
| Molecular Formula | C40H46FN3O7 |
| Molecular Weight | 699.82 g/mol |
| Exact Mass | 699.33 |
| IUPAC Name | (2S)-3-[2-[3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]-4-hydroxyphenyl]-2-[6-[[6-(4-fluorophenyl)-4-phenyl-2-pyridinyl]oxy]hexanoylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)C(N)CCc1cc(O)ccc1C[C@H](NC(=O)CCCCCOc1cc(-c2ccccc2)cc(-c2ccc(F)cc2)n1)C(=O)O |
| InChI | InChI=1S/C40H46FN3O7/c1-40(2,3)51-39(49)33(42)20-16-28-22-32(45)19-15-29(28)23-35(38(47)48)43-36(46)12-8-5-9-21-50-37-25-30(26-10-6-4-7-11-26)24-34(44-37)27-13-17-31(41)18-14-27/h4,6-7,10-11,13-15,17-19,22,24-25,33,35,45H,5,8-9,12,16,20-21,23,42H2,1-3H3,(H,43,46)(H,47,48)/t33?,35-/m0/s1 |
| InChIKey | KAZAQAWRGAHQPR-XZEQTHJSSA-N |
| XLogP | 6.61 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.82 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|